=Round each number to five decimal places: a. 23.54 b. 0.916?​

Answers

Answer 1

Therefore the rounded numbers are 23.54 and 0.9160.

Define rounded numbers.

An integer containing one or more "0"s at the end in a certain base is said to be round. In this way, 590 is more rounded than 592 but less rounded than 600. A round number is frequently understood to stand for a value or values close to the nominal value given in both formal and informal language.

What is integer?

Zero, a positive natural number, or a negative integer denoted by a minus sign are all examples of integers. The inverse additives of the equivalent positive numbers are the negative numbers. The set of integers is frequently represented in mathematical notation by the boldface Z or blackboard bold mathbb Z.

a. To round 23.54 to five decimal places, we look at the sixth decimal place, which is 4. Since 4 is less than 5, we leave the fifth decimal place as is, and the number rounded to five decimal places is 23.54.

b. To round 0.916 to five decimal places, we look at the sixth decimal place, which is 1. Since 1 is greater than or equal to 5, we increase the fifth decimal place by one, and the number rounded to five decimal places is 0.9160.

To know more about decimal numbers visit: https://brainly.com/question/4708407

#SPJ1


Related Questions

If A=(7,9) and B=(3,12) what is the length of AB

Answers

The distance between two points A and B is 5 units.

What role does place value have in finding 10% and 1% of a number? Write at least two complete sentences.

Answers

The fractions of the numbers are found as follows:

10% of a number is found moving the decimal digit one unit right.1% of a number is found moving the decimal digit two units right.

How to divide a number by powers of 10?

To divide a number by the nth power of 10, the decimal digit in the number is moved n units to the right.

The fraction that represents 10% of a number is given as follows:

10/100 = 1/10.

Meaning that the number is divided by 10, which is the first power of 10, and thus the decimal digit is moved one unit right in the number.

The fraction that represents 1% of a number is given as follows:

1/100.

Meaning that the number is divided by 100, which is the second power of 10, and thus the decimal digit is moved two units right in the number.

More can be learned about division by powers of 10 at https://brainly.com/question/29015488

#SPJ1

Find the total surface area of a cone with a base diameter of 7cm and height of 8cm

Answers

Answer: The formula for the surface area of a cone is S = π * r * s + π * r², where r is the radius of the base and s is the slant height of the cone.

To find the surface area of a cone, you first need to find the radius of the base. Since the base diameter is given as 7cm, you can divide this by 2 to find the radius of the base:

r = 7cm / 2 = 3.5cm

Next, you need to find the slant height of the cone. You can use the Pythagorean theorem to do this.

slant height = sqrt(r^2 + h^2) = sqrt(3.5² + 8²) = sqrt(12.25 + 64) = sqrt(76.25) = 8.766cm

Now you can substitute these values into the formula for the surface area of a cone and find the surface area of the cone.

S = π * r * s + π * r² = π * 3.5cm * 8.766cm + π * 3.5² cm² = 12.571 cm² + 38.485 cm² = 51.056 cm²

So the surface area of a cone with a base diameter of 7cm and height of 8cm is 51.056 cm²

Step-by-step explanation:

9. A triangle with a height of 12 inches has an area of 36 square inches. How long is the base of the triangle?







If anyone knows this please tell me this is due tommorow!​

Answers

Area = 1/2(base)(height)

36 = 1/2(base)(12)
36 = 6(base)
6 = base

The base is 6 inches long.

Answer:

Step-by-step explanation

The triangle base would be 6

Jay wants to go paddleboarding at least 8 hours each week. If he averages 2 hours per day, write and solve an inequality to find how many days he will have to go kayaking.​

Answers

An inequality to find how many days he will have to go kayaking. is; d ≥ 4

How to solve Inequality word problems?

We are told that Jay wants to go paddle boarding at least 8 hours each week. This means greater than or equal to 8. That is the minimum number of hours each week is 8 hours.

Now, we are told that he averages 2 hours per day. If the number of days is given by d, then we have the inequality as;

2d ≥ 8

Divide both sides by 2 to get;

d ≥ 4

That is the domain of the number of days required to go kayaking

Read more about Inequality word problems at; https://brainly.com/question/25275758

#SPJ1

Could someone help me

Answers

[tex]\cfrac{6a^2 + 21a}{3a^2}\implies \cfrac{6a^2 }{3a^2}+\cfrac{21a}{3a^2}\implies 2+\cfrac{7}{a}[/tex]

If triangle NPZ ~ triangle HBZ find the measure of angle B.
Please show the steps

Answers

The measure of  angle B is m ∠B = 107°.

What is similar triangles?

Triangles that are similar in shape but differ in size are known as similar triangles. Examples of related objects include all equilateral triangles and squares with any side length. To put it another way, if two triangles are similar, then their corresponding angles and sides are congruent and equal in size.

Given:   Δ NPZ ~ Δ HBZ

As the triangles NPZ and triangle HBZ are similar that means the corresponding angles are congruent.

⇒ ∠N = ∠H,  ∠P = ∠B,  ∠Z = ∠Z

Since,

∠P = (8x - 37)°,  ∠Z = 42°,  ∠H = (2x - 5)°

⇒ 2x - 5 = ∠H,  ∠B = 8x - 37,  Z = 42°

Since, the sum of three angles of triangle is 180°.

⇒              ∠H + ∠B + ∠Z = 180°

(2x - 5)° + (8x - 37)° + 42° = 180°

                10x - 42° + 42° = 180°

                                  10x = 180°

                                     x = 18°

So,

∠B = (8x - 37)° = 8(18) - 37 = 144 - 37 = 107°.

Hence, the measure of  angle B is m ∠B = 107°.

To know more about similar triangles, click on the link

https://brainly.com/question/14285697

#SPJ1

solve 2x+4y=4 -2x+y=-4 using substitution 

Answers

According to the solving by  using substitution method the  x and y are x = 6/5 and y = -8/5 respectively.

What is a method of substitution?

The algebraic approach to solving simultaneous linear equations is known as substitution method. The value of one variable through one equation is substituted in the second equation in this procedure, as the name implies.

According to the given information:

given equations are 2x+4y = 4 and -2x+ y = -4

Now, simplifying -2x+y = -4

-2x+y = -4

∴ y = -4 + 2x

i.e. y = 2x - 4

By substitution method,

y = 2x - 4 in other given equation 2x+4y = 4,

 2x+4y = 4

 2x+4(2x - 4) = 4

∴ 2x + 8x - 8 = 4

∴ 10x = 4 + 8

∴10x = 12

∴ x = 12/10

∴ x = 6/5

Now ,

substituting x = 6/5 in y = 2x - 4,

 y = 2(6/5) - 4

∴ y = - 8/5

∴ x = 6/5  &  y = - 8/5.

To learn more about substitution method click:

brainly.com/question/26094713

#SPJ1

There were 9 pieces of paper. Some of them were cut into 3 pieces. As a result, there
are now 15 pieces of paper. How many pieces of paper were cut?

Answers

Answer:15-9=3

6=3

6÷3

2 is the required answer for this question

Chapter 3 Lesson 4 Arithmetic Sequence

Answers

Answer:

Step-by-step explanation:

1) 1,15,29,43,57,.....

here, 15-1 =14 and 29-15=14

therefore,it is an arithmetic sequence with common difference = 14

2) 3,6,9,15,17,....

here, 6-3=3, 9-6=3 , 15-9=6

therefore,it is not an arithmetic sequence.

3) 93,86,79,72,65,......

here, 86-93=-7 , 79-86=-7 and 72-79=-7

therefore,it is an arithmetic sequence with common difference = -7

4) 37,34,31,29,26,......

here, 34-37 = -3,31 - 34 = -3,29 - 31 =-2

therefore,it is not an arithmetic sequence.

Consider y =f(x)=-3x+2 . Using space below, determine the equation that represents the inverse f(x)

Answers

Answer:   [tex]f^{-1}(\text{x}) = \frac{2-\text{x}}{3}[/tex]

Explanation:

Swap x and y, then solve for y to get the inverse.

[tex]f(\text{x}) = -3\text{x}+2\\\\\text{y} = -3\text{x}+2\\\\\text{x} = -3\text{y}+2\\\\\text{x}-2 = -3\text{y}\\\\\text{y} = \frac{\text{x}-2}{-3}\\\\\text{y} = \frac{2-\text{x}}{3}\\\\f^{-1}(\text{x}) = \frac{2-\text{x}}{3}\\\\[/tex]

please help quickly
If UY=13p-1 and VX=20p-95 than what is UY

Answers

Viewing the given triangle, the information given helped to determine side UY to be 90

What are similar triangles?

This is a term used in geometry to mean that the respective sides of the triangles are proportional and the corresponding angles of the triangles are congruent

Hence assuming the corresponding angles of the triangle are congruent then the side should be in proportions

Examining the figure shows that pair of equivalent sides are

WX and WY, XV and YU

The solution is worked out using sides WX and XV, WY and YU

WX / WY = XV / YU

WX / WY = 1/2 since it is a mid segment

1 / 2 = (20p - 95) / (13p - 1)

13p - 1 = 2 * (20p - 95)

13p - 1 = 40p - 190

190 - 1 = 40p - 13p

189 = 27p

p = 7

solving for UY

= 13p - 1

= 13 * 7 - 1

= 90

Learn more about similar triangles here:

https://brainly.com/question/29333623

#SPJ1

Unit 1 geometry basics Homework 2
pls help! i’ll mark brainliest

Answers

The value of AB= 24 BD is congruent to BC. BD=BC

BD = 5x – 26, BC = 2x + 1, and AC = 43

How to find value of AB?From the diagram , AC=AB+BCTo find out , we need to find  BC first . For that we have to find out xWE know that BD=BC, using that we solve for x5X-26=2X+1SUBSTRACT 2X3X-26=1ADD 263x=27x=9Now we plug in 9 for x  and find out BCBC=2x+1BC=2(9)+1BC=19We know AC= 43AC=AB+BC43=AB+19subtract 19AB=24

To learn more about find value of AB refers to:

brainly.com/question/11923213

#SPJ1

1. Marta walked 6 miles in 1.5 hours. At this rate how long will it take her to walk 16 miles?

2. Lionel typed 320 words in 4 minutes. At this rate, how long will it take him to type 800 words?

Answers

Answer for no.2: 800

Step-by-step explanation:

A farmer took 2/3 of the trawberrie that he harveted to a market. At the the market, the farmer old 1/4 of the trawberrie. How can you find what part of the trawberrie the farmer harveted were old at the market?

Answers

There are 5/12 strawberries were left. This can be solved using the concept of fraction addition.

What is fraction?

A fraction is a piece of the entire. The number is stated in arithmetic as a quotient, which signifies the numerator divided by the denominator. Both are integers in a straightforward fraction. The numerator or denominator of a complex fraction is a fraction. A suitable fraction has a numerator that is smaller than its denominator.

Three main fractional kinds exist. They come in three varieties: appropriate fractions, incorrect fractions, and mixed fractions. The numerator and denominator words are known as fractions. We define its kinds in light of these two words.

Given that,

A farmer took 2/3 of the strawberry that he harvested to a market.

At the market, the farmer sold 1/4th of the strawberry.

Now, the farmer has left no of strawberries were:

= (2/3) - (1/4)

= (8 - 3) / 12

= 5 / 12

To know more about fraction refer to:

brainly.com/question/17220365

#SPJ4

Which of these equations is equivalent to the following: 8/12 divided by 7/8=
Plsssss help me

Answers

Answer: o.7619

Step-by-step explanation: i used the standard algorithm i am sorry i cant do a more in depth just hard to do with words ;)

Answer: 0.7619

:)

Step-by-step explanation:

A line is perpendicular to y = x + 3
and intersects the point (-2, 4).
What is the equation of this
perpendicular line?
y = − ²x + [ ]
Hint: Use the Point-Slope Form:y-y₁ = m(x - X1)
Then write the equation in slope-intercept form.
Enter

Answers

Answer:

y =x+3

y =-x²+[?]

Find the gradient;

What is the formula for the gradient of a graph?

Finding the gradient of a straight-line graph

X2 = 2

Y2 = 7

ΔX = 4

ΔY = 3

θ = 36.869897645844°

Equation of the line:

y = 0.75x + 5.5

When x=0, y = 5.5

When y=0, x = -7.3333333333333

OR

X2 = -6

Y2 = 1

ΔX = -4

ΔY = -3

θ = 216.86989764584°

Equation of the line:

y = 0.75x + 5.5

When x=0, y = 5.5

When y=0, x = -7.3333333333333

Don’t know need help

Answers

The meaning of adjoining  is nearby or next to.

What is meant by adjoining?

The terms neighboring, adjoining, contiguous, and juxtaposed denote close closeness. Adjacent may or may not indicate touch, but it always implies the lack of something like in between. A home with a garage attached. Adjoining means meeting and touching at some point or line. Two nearby dwellings are an example of adjacent. People on our block are typically considered our neighbors.

In the English language, “adjacent to” means “next to.” For two angles to be adjacent, they must meet the following three conditions: 1. The two angles must share (or have the same) side. 2. They must share a vertex (i.e. a common starting point for the sides).

To learn more about adjoining to refer:

https://brainly.com/question/16885438

#SPJ1

PS is the length of either segment multiplied by two ,PS is 38.

How to find PS?

A line connecting the vertex with the middle of the other side forms the median angle. As a result, we may state that PR = QS for the provided.

By equating PR and QS, we can determine X's value.

PR = QS

5x-11 = 2x+7

Combine related terms to get 5x-2x = 7+11; divide both sides by 3 to get the x value; and last, multiply the result by 2 to get x = 6.

Find the value of PR and QS, and we'll demonstrate that two are equal as a result.

Correct: 5(6)-11 = 2(6)+7 19 = 19.

PS is the length of either segment multiplied by two, or simply the product of PR and QS.

PS = 19 x 2 = 19 + 19 = 38 (D) (D)

To learn more about angle refer to:

https://brainly.com/question/25716982

#SPJ1

what is -7 divided by 3/4 ?

Answers

Answer:

-9.333333333333333333333

Step-by-step explanation:

Answer-9 1/3

Step-by-step example

first, multiply 7x4 over 3 then next to that cross multiply that with 28 over 3

then simply that which’s gets to 28 over 3 then you get your answer 9.3333 then simplify that and you get 9 1/3

at the same time that a 60 foot tall buidling casts s shadow hat is 21.5 feet long a nearby tree casts a shadow that is 18 feet long, Which measure is closest to the height of the tree

Answers

The height of the tree is closest to 40 feet.

We can use the proportion of similar triangles to determine the height of the tree.

Let h be the height of the tree and s be the length of the shadow cast by the tree.

We know that the height of the building is 60 feet and the length of its shadow is 21.5 feet. So:

(h/s) = (60/21.5)

 

We also know that the length of the shadow cast by the tree is 18 feet.

So we can substitute that into the proportion and solve for h:

h = (60/21.5) * 18

h = (60*18)/21.5

h ≈ 40

To know more about proportion of similar triangles refer to:

https://brainly.com/question/28786152

#SPJ4

T h e r e a r e 235 seven t h - g r a d e st u d e n t s g o i n g o n a fi e l d t r i p . T h e sc h o o l h a s 5 b u se s t o t a k e t h e st u d e n t s. E a c h b u s h a s 22 se a t s, a n d 2 st u d e n t s c a n si t i n e a c h se a t . B a se d o n t h i s i n f o r m a t i o n , h o w m a n y st u d e n t s w i l l n o t b e a b l e t o r i d e o n a b u s f o r t h e fi e l d t r i p ?

Answers

The number of students who will not be able to ride on the bus for the school trip is given by the equation A = 15 students

What is an Equation?

Equations are mathematical statements with two algebraic expressions flanking the equals (=) sign on either side.

It demonstrates the equality of the relationship between the expressions printed on the left and right sides.

Coefficients, variables, operators, constants, terms, expressions, and the equal to sign are some of the components of an equation. The "=" sign and terms on both sides must always be present when writing an equation.

Given data ,

Let the equation be represented as A

Now , the value of A is

The total number of students for the trip = 235 students

The number of buses = 5 buses

The number of students in a bus be = B

Now , each seat on the bus can occupy = 2 students

So , 22 seats can occupy = 22 x 2 students

22 seats in the bus can occupy = 44 students

So , the number of students in a bus B = 44 students

And , the total number of students in 5 buses = 5 x number of students in a bus B

Substituting the values in the equation , we get

The total number of students in 5 buses = 5 x 44

The total number of students in 5 buses = 220 students

So , the remaining number of students A = total number of students for the trip - total number of students in 5 buses

Substituting the values in the equation , we get

The remaining number of students A = 235 - 220

The remaining number of students A = 15 students

Therefore , the value of A is 15 students

Hence , the number of students is 15 students

To learn more about equations click :

https://brainly.com/question/19297665

#SPJ1

If Point B represents an alternate combination of flutternutters & blank books, then how much of each product could be produced?

Answers

From the given graph, at Point B a total of 8000 fluffernutters & 500 blank books could be produced.

The study of graphs, which are mathematical constructions used to represent pairwise relationships between things, is known as graph theory in mathematics. In this context, a graph is made up of vertices connected by edges.

In discrete mathematics, a graph is made up of vertices—a collection of points—and edges—the lines connecting those vertices. In addition to linked and disconnected graphs, weighted graphs, bipartite graphs, directed and undirected graphs, and simple graphs, there are many other forms of graphs.

Straight line graphs called linear graphs are used to show the relationship between two quantities. This graph makes it easier to show a result as a collection of straight lines. The term "linear" simply means a straight line; curves, dots, bars, etc. are not used.

To learn more about graphs from given link

https://brainly.com/question/30057644

#SPJ1

Before taking his last test in a class, the arithmetic mean of Brian's test scores is 91. He has determined that if he scores 98 on his last test, the arithmetic mean of all his test scores will be exactly 92. How many tests, including the last test, does Brian take for this class

Answers

On solving the provided question, we can say that the mean that 6 tests including the last test brian took.

What is mean?

A dataset's mean is the sum of all values divided by the total number of values, often known as the arithmetic mean (as opposed to the geometric mean). Often referred to as the "mean," this is the most often used measure of central tendency. Simply dividing the dataset's total number of values by the sum of all of those values yields this result. Both raw data and data that have been combined into frequency tables can be used for calculations. Average refers to a number's average. It is straightforward to calculate: Divide by how many digits there are after adding up all the digits. the total divided by the count.

(91n + 98) / (n + 1)  =  92

    91n + 98  =  92(n + 1)

 91n + 98  =  92n + 92

 98  =  n + 92

6  =  n

To know more about mean visit:

https://brainly.com/question/30094057

#SPJ4

Convert 1.45454... into a ratio of two integers. Enter your answer as a fraction in lowest terms.​

Answers

Answer:

16/11

Step-by-step explanation:

Let x = 1.45454...

Multiply both sides by 100:

100x = 145.454...

Subtract both sides by x:

100x - x = 145.454... - x

100x - x = 145.454... - 1.45454...

99x = 144

x = 144/99

The term can be simplified in lowest as 16/11. Hence, 1.45454... can be written as the ratio of two integers of 16/11

A line has a slope of – 1/7 and passes through the point (4,5). What is its equation in point-slope form?

Answers

Answer:

y-5=-1/7(x-4)

Step-by-step explanation:

The equation of the line in point-slope form is y-5=-1/7(x-4)

Answer:

y = -1/7 x + 39/7

Step-by-step explanation:

An equation in point slope form is

y = mx+b  where m is the slope and b is the y intercept

We are given the slope

y = -1/7 x + b

Substitute in the point for x and y and solve for b

5 = -1/7(4) +b

5 = -4/7 +b

5 + 4/7 = b

5*7/7 + 4/7 = b

35/7 + 4/7 = b

39/7 = b

The equation is

y = -1/7 x + 39/7

3) Camile offers you a challenge. Are the triangles below similar? Examine them and tell how
you know.

a) Use a flowchart to organize your explanation.
b) Camile says, "These triangles aren't just similar-they're congruent!" Is Camile
correct? What special value in your flowchart indicates that the triangles are
congruent?

Answers

a) The flowchart for the congruency of triangles is given below.

b) The triangles are congruent as DQ ≅ XZ, PQ ≅ XY, and ∠PQD ≅ ∠ZXY.

What is congruency?

The word 'congruent' means 'exactly equal' in terms of shape and size. Even when we turn, flip, or rotate the shapes, they remain equal.

In the given diagram, it can be seen that -

Line segment DQ = Line segment XZ.

Similarly, Line segment PQ = Line segment XY.

Since, the two sides of the triangle are equal, hence the third side must also be equal.

Line segment PD = Line segment ZY.

Also, in the diagram it can be seen that ∠PQD ≅ ∠ZXY.

Therefore, the triangles PDQ and ZXY are equal and congruent.

The flowchart for the same is given below.

To learn more about congruency from the given link

https://brainly.com/question/2938476

#SPJ1

Barrett earns $15 per hour cutting grass and $10 per hour tutoring reading. In one month, Barrett
needs to save at least $400 for a new lawnmower but does not want to work more than 35 hours.
Part A: Let x represent the hours cutting grass and y represent the hours tutoring. Given x ≥ 0 and
y ≥ 0, select all the inequalities that represent the situation.
A. x + y ≥ 35
B. 15x + 10y ≤ 400
C. x + y ≤ 35
D. 15x + 10y ≥ 400
E. 25x + 25y ≤ 400
F. 15x + 10y ≤ 35

Part B: Determine whether each point is a viable or nonviable solution according to the above scenario.

Viable Nonviable

(10, 25)

(10, 20)
(20, 12)
(35, 0)
(20, 20)

Answers

The inequalities that represent the situation are 15x + 10y ≥ 400 and x + y ≤ 35 and the viable solutions are (10, 25), (20, 12), (35, 0) and (20, 20)

The inequalities that represent the situation.

From the question, we have the following parameters that can be used in our computation:

Earnings from cutting = $15Earning from tutoring = $10Number of hours = not more than 35Total earnings = At least $400

These parameters above mean that

15x + 10y = Total earnings

x + y = Number of hours

So, we have

15x + 10y ≥ 400

x + y ≤ 35

The above represent the inequalities of the situation

The viable solutions

In (a), we have

15x + 10y ≥ 400

x + y ≤ 35

Next, we test the options

(10, 25)

15 * 10 + 10 * 25 ≥ 400 ⇒ 400 ≥ 400

10 + 25 ≤ 35 ⇒ 35 ≤ 35

True

(10, 20)

15 * 10 + 10 * 20 ≥ 400 ⇒ 350 ≥ 400

10 + 20 ≤ 35 ⇒ 30 ≤ 35

False

(20, 12)

15 * 20 + 10 * 12 ≥ 400 ⇒ 420 ≥ 400

20 + 12 ≤ 35 ⇒ 32 ≤ 35

True

(35, 0)

15 * 35 + 10 * 0 ≥ 400 ⇒ 525 ≥ 400

35 + 0 ≤ 35 ⇒ 35 ≤ 35

True

(20, 20)

15 * 20 + 10 * 20 ≥ 400 ⇒ 500 ≥ 400

20 + 20 ≤ 35 ⇒ 40 ≤ 35

False

Hence, the viable solutions are (10, 25), (20, 12), (35, 0) and (20, 20)

Read more about inequality at

https://brainly.com/question/25275758

#SPJ1

What is the solution to the system of equations 3x 2y 7 and Y 3x 11?

Answers

The solution to the system of equations is x = 4 and y = 5.

3x + 2y = 7

y = 3x - 11

Substitute 3x - 11 for y in the first equation:

3x + 2(3x - 11) = 7

Simplify:

3x + 6x - 22 = 7

Combine like terms:

9x - 22 = 7

Add 22 to both sides:

9x = 29

Divide both sides by 9:

x = 29/9

x = 4

Change x in the second equation to 4:

y = 3(4) - 11

Simplify:

y = 12 - 11

y = 1

The solution to the system of equations is x = 4 and y = 1.

The solution to the system of equations 3x + 2y = 7 and y = 3x - 11 is x = 4 and y = 1. To solve this system, we first substituted 3x - 11 for y in the first equation. We then simplified the equation and combined like terms to get 9x - 22 = 7. We then added 22 to both sides, divided both sides by 9, and got x = 29/9 which is x = 4. We then substituted 4 for x in the second equation, simplified, and got y = 1. Thus, the solution to the system of equations is x = 4 and y = 1.

Learn more about equation here

https://brainly.com/question/29657992

#SPJ4

You have $12 to spend at a vending machine. A pack of Starbursts cost $1 and a pack of M&M chocolates cost $2. You want to buy at least three packs of Starbursts.

a. Write a system of linear inequalities that represents this situation.
b. How many packs of each type of candy can you possibly purchase?

Answers

Answer:yes

Step-by-step explanation:

yes

Answer:

Starbursts = 12 dollars

M&M = 2 dollars

1. Make Startbursts and M&Ms into "x"

(a) 1x + 2x = 12

2. 3*1= 3

4+2x=12

(b) 4 packs

In an amphitheater, eat are aranged in 50 emi-circular rowfacing a dome tate. The firt row contain 23 eat, and each row contain4more eat than the previou row. How many eat are in the amphitheater?

Answers

In an amphitheater, seat are arranged in 50 semi-circular row-facing a dome Tate. The first row contain 23 seat, and each row contain 4 more eat than the previous row. Therefore, there are 6050 seat are in the amphitheater.

Given that:

There are total 50 semi circular row.

In the first row there are 23 seats.

The given problem is AP series:

Arithmetic Series:

An arithmetic sequence is defined as an algebraic sequence in which each successive term has an equal difference. It is obtained by adding a constant to any preceding term. For the first term 'a' and the tolerance 'd' of the AP, here is a list of commonly used arithmetic progressions to solve various AP related problems:

Common Difference of AP: d = a2 - a1 = a3 - a2 = a4 - a3 = an - a(n-1)  nth term of AP.AP: an = a + (n - 1)d of AP Sum of n terms: Sn = n/ 2( 2a+(n-1)d) = n/2(a + l),

where l is the last term in the arithmetic progression.

Now,

Sum of n terms  = n/2 [ 2a + (n-1)d]

                          = 50/2 [ 2× 23 + (50 -1)4]

                          = 25 [46 + 49×4]

                          = 25 × 242

                          = 6050

Learn more about Semi circular Row Facing:

https://brainly.com/question/13135497

#SPJ4

Other Questions
Your essay will be about one of the important events in America between 1800-1825 you just read about. Your essay should Be 4-5 paragraphs in length.Explain multiple causes of the event, why the event is important, and the impacts it had on the nation. Freud is to psychoanalytic theory as Allport is to ______ theory. A) behavioral. B) humanistic. C) trait. D) social-cognitive. Audit firms are increasingly considering operational data such as manufacturing logs, customer relationship management data and supply chain data primarily to 15. Malik used the method of elimination to solve the system below.4x+3y=122x+y=5(a) Malik first rewrote the second equation as:-6x-3y=-15What property justifies writing this equation?(b) Malik correctly solves this system usielimination. Was the value he found forlarger or smaller than 1? Justify. Angie is working on solving the exponential equation 23x = 6; however, she is not quite sure where to start. Using complete sentences, describe to Angie how to solve this equation.Hint: Use the change of base formula: log base b of y equals log y over log b. Set V Is all do you need three digit numbers using the digits 1,2,3,4 and 5. Which set would be considered a subset V Why did President Roosevelt support U.S. participation in the United Nations? a virtual museum display what are some things about virtual museums intelligence, surveillance, and reconnaissance (ISR) and Missile warning are typically in these orbits: Why are the Elgin Marbles so important to Greece? 3 times one number minus a second is 8 and the sum of the numbers is 12 John gains 5% by selling a book for 273. Find the cost price of the book What is the cycle of money? Who participates in the cycle of money? What is the objective of a financial transaction? What is the writing style of the author *? A doctor gives 10 patients Drug A and 10 patients Drug B and records the differences. Is this an observation, survey, experiment, or simulation? What specific host gene functions would you consider as strong candidates for such methylation by infecting viruses Read this short poem by Sarah Teasdale. It was written during World War I to encourage readers that, even after the senseless destruction of war, nature will survive and thrive.(War Time)There will come soft rains and the smell of the ground,And swallows circling with their shimmering sound;And frogs in the pools singing at night,And wild plum trees in tremulous white,Robins will wear their feathery fireWhistling their whims on a low fence-wire;And not one will know of the war, not oneWill care at last when it is done.Not one would mind, neither bird nor treeIf mankind perished utterly;And Spring herself, when she woke at dawn,Would scarcely know that we were gone.Does this poem share the opinion of "Ozymandias" about the relationship between mankind and nature? Do the poems share the opinion that nature simply does not care about humans or human society?Give your thoughtful opinion in 35 sentences. Farmers Lirn and Rew both bought gespils and alabers for their farms. Lirn bought 8 gespils and 9 alabers for $117. Rew bought 3 gespils and 8 alabers for $67. Write a system of equations, in standard form, modeling the relationship between cost of gespils (x) and cost of alabers (y). Use the binomial theorem to expand expressions 1-4 and answer question 5.1. (3x^2 +y)^32. (5x^4 +2y^5)^43. (x^3 +4y^2)^54. (x-2y)^65. find the coefficient of x^3 y^4 in the expansion of (2x+5y^2)^5 The Gestalt principle of simplicity represents the tendency for individuals to arrange elements in a way that creates closure or completeness. T/F