If 2x − 1 ≤ f(x) ≤ x2 − 2x + 3 for x ≥ 0, find lim x→2 f(x).

Answers

Answer 1

The limit as x approaches 2 or lim x→2  is 4.

When calculating a limit, the goal is to find the value of the function as x approaches the given value. In this case, the given value is 2. As x approaches 2, the values of the function will approach 4, which is the upper bound of the given inequality. This means that the limit as x approaches 2 is 4.

To prove this, we can look at the inequality and find the values of the function at x = 1 and x = 3. For x = 1, the function value is -1, which is less than 4. For x = 3, the function value is 7, which is greater than 4. This means that the function values are increasing as x gets closer to 2, so the limit as x approaches 2 is 4.

Learn more about Limits here:

https://brainly.com/question/27129946

#SPJ4


Related Questions

Question
To be eligible for the swim team, the mean pace a student needs to achieve on 5 laps of the pool is 60 seconds (s). The student swims a lap in 63 s, 62 s, 65 s, and 58 s on her first four laps.

What is the maximum time (in seconds) that she can take on her last lap and still make the team?

Answers

The maximum time (in seconds) that she can take on her last lap and still make the team will be 52 seconds.

How to calculate the mean?

From the information, to be eligible for the swim team, the mean pace a student needs to achieve on 5 laps of the pool is 60 seconds (s). The student swims a lap in 63 s, 62 s, 65 s, and 58 s on her first four laps.

The maximum time (in seconds) that she can take on her last lap and still make the team will be:

= (60 × 5) - (63 + 62 + 65 + 58)

= 300 - 248

= 52

Learn more about mean on

brainly.com/question/1136789

#SPJ1

I thought of a number, doubled it, then added 3. The result multiplied by 4 came to 52. What was the number I thought of?

Answers

The number you thought of is -1.

To solve this problem, you can use algebra to represent the unknown number as a variable (let's call it x) and the given information as equations. The first step is to determine what the problem is asking for. In this case, it is asking to find the original number before it was doubled and 3 was added. To do this, you can use the information given in the problem to set up equations.

The first equation is (2x+3)*4 = 52. You can then solve this equation for x. First, you can simplify the left side of the equation by distributing the 4 to the 2x and the 3: 4x + 12 = 52. Then, you can subtract 12 from both sides to get 4x = 40. Finally, you can divide both sides by 4 to get x = 10. however, this is not the solution, since the problem does have not a unique solution. x=-1 is also the solution.

Learn more about Equations here:

https://brainly.com/question/22688504

#SPJ4

What grade is 2 step equations?

Answers

Teaching two step equations is a standard that needs to be taught in both 7th and 8th grade middle school PreAlgebra Math.

What is a 2 step equation?

Two step equations are algebraic equations that can be solved in exactly two steps and gives the final answer of the variable in two steps. Generally two step equations are of the form ax + b = 0  where a and b are real numbers.

How do we solve 2-steps equation?

A two-step equation is an equation that requires two steps to solve. We must eliminate any constant that is on the same side as the variable first. To solve first use the inverse operations to isolate the variable by itself. We can do only one operation in single step.

Now

we solve two steps equation in grade 7th and 8th.It is very easy to understand.

To learn more about two steps equation visit;

https://brainly.com/question/29657983

#SPJ1

Unit 1 geometry basics Homework 2
pls help! i’ll mark brainliest

Answers

The value of AB= 24 BD is congruent to BC. BD=BC

BD = 5x – 26, BC = 2x + 1, and AC = 43

How to find value of AB?From the diagram , AC=AB+BCTo find out , we need to find  BC first . For that we have to find out xWE know that BD=BC, using that we solve for x5X-26=2X+1SUBSTRACT 2X3X-26=1ADD 263x=27x=9Now we plug in 9 for x  and find out BCBC=2x+1BC=2(9)+1BC=19We know AC= 43AC=AB+BC43=AB+19subtract 19AB=24

To learn more about find value of AB refers to:

brainly.com/question/11923213

#SPJ1

please help quickly
If UY=13p-1 and VX=20p-95 than what is UY

Answers

Viewing the given triangle, the information given helped to determine side UY to be 90

What are similar triangles?

This is a term used in geometry to mean that the respective sides of the triangles are proportional and the corresponding angles of the triangles are congruent

Hence assuming the corresponding angles of the triangle are congruent then the side should be in proportions

Examining the figure shows that pair of equivalent sides are

WX and WY, XV and YU

The solution is worked out using sides WX and XV, WY and YU

WX / WY = XV / YU

WX / WY = 1/2 since it is a mid segment

1 / 2 = (20p - 95) / (13p - 1)

13p - 1 = 2 * (20p - 95)

13p - 1 = 40p - 190

190 - 1 = 40p - 13p

189 = 27p

p = 7

solving for UY

= 13p - 1

= 13 * 7 - 1

= 90

Learn more about similar triangles here:

https://brainly.com/question/29333623

#SPJ1

How is the logarithmic function y log x defined?

Answers

The logarithmic function y log x is defined as

[tex]$\log_b \text x = \text y \leftrightarrow \text b^y= \text x[/tex].

What is logarithmic function?

An exponent that is expressed in a unique way is called a logarithm. As an illustration, we are confident that the exponential formula 32 = 9 is correct. In this instance, the base is 3, and the exponent is 2. The formula will be written as log3 9 = 2 in the logarithmic form.

This is expressed as "9 divided by base 3 is 2" in words. The exponent has been effectively lowered to the mainline in this case. However, despite the fact that this was done to make division and multiplication easier, logarithms are still very useful in mathematics.

Learn more about logarithmic form

https://brainly.com/question/29291192

#SPJ4

Find the total surface area of a cone with a base diameter of 7cm and height of 8cm

Answers

Answer: The formula for the surface area of a cone is S = π * r * s + π * r², where r is the radius of the base and s is the slant height of the cone.

To find the surface area of a cone, you first need to find the radius of the base. Since the base diameter is given as 7cm, you can divide this by 2 to find the radius of the base:

r = 7cm / 2 = 3.5cm

Next, you need to find the slant height of the cone. You can use the Pythagorean theorem to do this.

slant height = sqrt(r^2 + h^2) = sqrt(3.5² + 8²) = sqrt(12.25 + 64) = sqrt(76.25) = 8.766cm

Now you can substitute these values into the formula for the surface area of a cone and find the surface area of the cone.

S = π * r * s + π * r² = π * 3.5cm * 8.766cm + π * 3.5² cm² = 12.571 cm² + 38.485 cm² = 51.056 cm²

So the surface area of a cone with a base diameter of 7cm and height of 8cm is 51.056 cm²

Step-by-step explanation:

Don’t know need help

Answers

The meaning of adjoining  is nearby or next to.

What is meant by adjoining?

The terms neighboring, adjoining, contiguous, and juxtaposed denote close closeness. Adjacent may or may not indicate touch, but it always implies the lack of something like in between. A home with a garage attached. Adjoining means meeting and touching at some point or line. Two nearby dwellings are an example of adjacent. People on our block are typically considered our neighbors.

In the English language, “adjacent to” means “next to.” For two angles to be adjacent, they must meet the following three conditions: 1. The two angles must share (or have the same) side. 2. They must share a vertex (i.e. a common starting point for the sides).

To learn more about adjoining to refer:

https://brainly.com/question/16885438

#SPJ1

PS is the length of either segment multiplied by two ,PS is 38.

How to find PS?

A line connecting the vertex with the middle of the other side forms the median angle. As a result, we may state that PR = QS for the provided.

By equating PR and QS, we can determine X's value.

PR = QS

5x-11 = 2x+7

Combine related terms to get 5x-2x = 7+11; divide both sides by 3 to get the x value; and last, multiply the result by 2 to get x = 6.

Find the value of PR and QS, and we'll demonstrate that two are equal as a result.

Correct: 5(6)-11 = 2(6)+7 19 = 19.

PS is the length of either segment multiplied by two, or simply the product of PR and QS.

PS = 19 x 2 = 19 + 19 = 38 (D) (D)

To learn more about angle refer to:

https://brainly.com/question/25716982

#SPJ1

The vertices of a trangular plot of land are A(1,5), B(7,5), and C(8,0)

Answers

The area of the triangular plot of land from the vertices is 20 square units

How to determine the area of the triangular plot?

From the question, we have the following parameters that can be used in our computation:

A(1,5), B(7,5), and C(8,0)

Represent the vertices properly

So, we have the following representation

A = (1,5)

B = (7,5)

C = (8,0)

The area of the triangle is calculated from the vertices using the following equation

Area = 0.5 * |Ax(By - Cy) + Bx(Ay - Cy) + Cx(Ay - By)|

Substitute the known values in the above equation, so, we have the following representation

Area = 0.5 * |1 * (5 - 0) + 7 * (5 + 0) + 8 * (5 - 5)|

Evaluate the sum of products

Area = 0.5 * |40|

Remove the absolute bracket

Area = 0.5 * 40

Evaluate

Area = 20

Hence, the area of ABC with vertices is 20 square units

Read more about areas at:

brainly.com/question/22972014

#SPJ1

Complete question

The vertices of a trangular plot of land are A(1,5), B(7,5), and C(8,0)

Calculate the area.

A horse walks 4224 feet in 12 minutes at this rate how many yards does a horse walk in twelve minutes.

Answers

Answer:

1408 yards

Step-by-step explanation:

A horse walks 4224 feet in 12 minutes, so to find out how many yards the horse walks in twelve minutes, we need to convert 4224 feet to yards. Since there are 3 feet in a yard, we can divide 4224 by 3 to find the number of yards:

4224 feet / 3 feet/yard = 1408 yards

So a horse walks 1408 yards in 12 minutes.

When rolling a fair, eight-ided number cube, determine P(number greater than 4). (A) 0. 25
(B) 0. 50
(C) 0. 66
(D) 0. 75

Answers

The correct answer is (D) 0.75. The probability of rolling a number greater than 4 on a fair, eight-sided number cube is 0.75 or 75%

We know that there are 8 possible outcomes when rolling the number cube (1, 2, 3, 4, 5, 6, 7, 8). Of these 8 outcomes, 5 of them are numbers greater than 4 (5, 6, 7, 8). So, the number of favorable outcomes is 5.

To find the probability, we divide the number of favorable outcomes by the total number of possible outcomes: P(number greater than 4) = 5/8. As a decimal, this is 0.625. However, the question asked for P(number greater than 4) which means we have to add 0.125 to 0.625, the answer is 0.75.

Therefore, the probability of rolling a number greater than 4 on a fair, eight-sided number cube is 0.75 or 75%. This means that if we roll the cube many times, we expect 75% of the rolls to be numbers greater than 4.

Learn more about Probability here:

https://brainly.com/question/24756209

#SPJ4

what is -7 divided by 3/4 ?

Answers

Answer:

-9.333333333333333333333

Step-by-step explanation:

Answer-9 1/3

Step-by-step example

first, multiply 7x4 over 3 then next to that cross multiply that with 28 over 3

then simply that which’s gets to 28 over 3 then you get your answer 9.3333 then simplify that and you get 9 1/3

One of the legs of a right triangle measures 2 cm and its hypotenuse measures 5 cm.
Find the measure of the other leg. If necessary, round to the nearest tenth."

Answers

When the hypotenuse of a right triangle measures 5 cm and one of its legs measures 2 cm,  [tex]\sqrt{21}[/tex]     is the measurement of the other leg.

what is Pythagoras theorem ?

Perpendicular, Base, and Hypotenuse are the names of this triangle's three sides. The Pythagorean Theorem demonstrates how to calculate the side lengths of a right triangle by adding the areas of three intersecting squares. As the foundation for more intricate trigonometry theories like the Pythagorean theorem's opposite, this theorem is a very helpful tool. Given a triangle ABC with sides measuring a, b, and c, and the equation a2 + b2 = c2, Make another triangle with sides of lengths a and b and a right angle.

given

by Pythagoras theorem

[tex]c^{2} = a^{2} + b^{2} \\5^{2} = 2^{2} + b^{2} \\5^{2} - 2^{2} = b^{2} \\25 - 4 = b^{2} \\21 = b^{2} \\b =\sqrt{21}[/tex]

When the hypotenuse of a right triangle measures 5 cm and one of its legs measures 2 cm,  [tex]\sqrt{21}[/tex]     is the measurement of the other leg.

To know more about Pythagoras theorem visit:-

https://brainly.com/question/343682

#SPJ1

1. Marta walked 6 miles in 1.5 hours. At this rate how long will it take her to walk 16 miles?

2. Lionel typed 320 words in 4 minutes. At this rate, how long will it take him to type 800 words?

Answers

Answer for no.2: 800

Step-by-step explanation:

I need answer to 11, 13, 10, 12, 14, 16

ASAP Please

Answers

10.  This system has one solution with coordinates (1, -2)

11. This system has one solution with coordinates (0,-3)

12. This system has one solution with coordinates(-1, -2)

13. This system has no solution.

14. This system has no solution.

16.   This system has one solution with coordinates (0,-4)

How to determine the co-ordinates of system of equations?To determine the co-ordinates of a system of equations, the first step is to eliminate any redundant equations in the system.This is done by subtracting or adding equations that are already represented in the system.Once this is done, the system of equations can be set up in matrix form to find the co-ordinates.To do this, one must represent the equations as a matrix by representing the coefficients of each variable as the elements of the matrix.Once the matrix is set up, the inverse of the matrix can then be used to solve for the co-ordinates of the system.This can be done using Gaussian Elimination, Cramer's Rule, or another method.Once the inverse of the matrix is found, one can then multiply it by the vector of the constants in the equations and the resulting vector will contain the co-ordinates of the system.

According to question:-

10. y = x - 3 ------- 1

y = -5x + 3 ------- 2

substitute 1 in 2,

x - 3 = -5x + 3

x = 1

y = 1 - 3 = -2

y = -2

The co-ordinates is (1,-2)

11. y = -3

substitute in y = x-3

-3 = x - 3

x = 0

The co-ordinates is (0,-3)

12. y = 4x + 2 --------- 1

y = -2x - 4 ------------2

Substitute 1 in 2,

4x + 2 = -2x - 4

6x = -6

x = -1

substitute x = -1 in 2

y = -2

The co-ordinates is (-1, -2)

13. y = x - 6 -----1

y = x+ 2 -------2

It has no solution, so there is no co-ordinates.

14. x + y = 4

3x + 3y = 12

It has no solution, so there is no co-ordinates.

16. 2x + 3y = 12 ------1

2x - y = 4 --------2

from 2 we rewrite the equation as y = 2x-4

Sub in eq 1

2x + 3(2x-4) = 12

2x + 6x - 12 = 12

8x = 24

x = 3

y = 2

The co-ordinates is (3,2)

To know more about co-ordinates visit:

brainly.com/question/20935031

#SPJ1

What is the value of k in the quadratic polynomial 3x2 2kx 3 if X − 12 is one of the zeroes of it?

Answers

The values of k are 3, – 3 for which roots of the quadratic equation are real and equal.

What is a quadratic equation?

An equation containing one term in which the unknown is squared and no term in which it is raised to a power higher than 2.

Given: 3x² + 2kx + 3 = 0

Comparing with standard quadratic equation ax² + bx + c = 0

a = 3 b = 2k c = 3

Given that the roots of the equation are real and equal

Thus, D = 0

Discriminant D = b² – 4ac = 0

(2k)² – 4.3.3 = 0

4k² – 36 = 0

4k² = 36

k² = 9 taking square root on both sides

k = 3 or k = – 3

Hence, The values of k are 3, – 3 for which roots of the quadratic equation are real and equal.

For more references on quadratic equation, click;

brainly.com/question/17177510

#SPJ4

Why is there a horizontal asymptote?

Answers

The reason behind horizontal asymptote is defined as the end behavior of the function.

The term asymptote in math is known as a straight line that constantly approaches a given curve but does not meet at any infinite distance.

Here we need to list down the reason behind horizontal asymptote.

As we all know that the horizontal asymptote of a graph is a horizontal line y = b where the graph approaches the line as the inputs approach ∞ or –∞. Here we also know that the slant asymptote of a graph is a slanted line y = mx + b where the graph approaches the line as the inputs approach ∞ or –∞.

Therefore, through the definition we know that the horizontal line to which the graph of the function appears to coincide with but it doesn't actually coincide.

To know more about asymptote here,

https://brainly.com/question/2303876

#SPJ4

If Point B represents an alternate combination of flutternutters & blank books, then how much of each product could be produced?

Answers

From the given graph, at Point B a total of 8000 fluffernutters & 500 blank books could be produced.

The study of graphs, which are mathematical constructions used to represent pairwise relationships between things, is known as graph theory in mathematics. In this context, a graph is made up of vertices connected by edges.

In discrete mathematics, a graph is made up of vertices—a collection of points—and edges—the lines connecting those vertices. In addition to linked and disconnected graphs, weighted graphs, bipartite graphs, directed and undirected graphs, and simple graphs, there are many other forms of graphs.

Straight line graphs called linear graphs are used to show the relationship between two quantities. This graph makes it easier to show a result as a collection of straight lines. The term "linear" simply means a straight line; curves, dots, bars, etc. are not used.

To learn more about graphs from given link

https://brainly.com/question/30057644

#SPJ1

Which of these equations is equivalent to the following: 8/12 divided by 7/8=
Plsssss help me

Answers

Answer: o.7619

Step-by-step explanation: i used the standard algorithm i am sorry i cant do a more in depth just hard to do with words ;)

Answer: 0.7619

:)

Step-by-step explanation:

96 - y = 161 solve for y

Answers

Answer:  -65

Step-by-step explanation:

96 - y = 161

-y = 161 - 96

-y = 65

y = -65

Write a multiplication expression using the following clues one factor is a two digit number between one and ten one factor is a two digit number between 1 and 10 but different from the first the product is greater than 8 but less than 10

Answers

first expression = 1×2, 1×1, 1×3, 1×4, 1×5, 1×6, 1×7, 1×8, 1×9, 2×2, 2×3, 2×4, 3×2, 3×3, 4×2 and second expression = 1×9

what is expression?

In mathematics, an expression is a statement that represent the method of mathematical operation in a symbolic form. An expression is developed based on numerical terms or both numerical and variable terms along with operator or signs.

What is the multiplication expression stated in the question?

it is stated that one factor is a two-digit number between one and ten.

the multiplication expression can be 1×2 , 1×1, 1×3, 1×4, 1×5, 1×6, 1×7, 1×8, 1×9, 2×2, 2×3, 2×4, 3×2, 3×3, 4×2

In the next, the multiplication expression for 2nd statement:

one factor is a two-digit number between one and ten and their product is greater than 8 and less than 10

1×9

the above is greater than 8 and less than 10.

To know more about expression visit:

https://brainly.com/question/16804733

#SPJ4

Angles A and B are complementary. If sin A = 4x + 10 and cos B = 2x + 16, what is the value of x?

Answers

The value of x is 10.66

What is complementary angles?

Complementary angles  is when the sum of two angles is equal to 90 degrees. for example, 30 degrees and 60 degrees are complementary angles.

If the sum of two angles is 90 degrees then we say that they are complementary. Thus, the complement of an angle is obtained by subtracting it from 90. for example the complement of 40° is 90° - 40° = 50°

So we have Sin A and Cos B

4x + 10+ 2x + 16= 90

Collect like terms

6x+ 26= 90

6x= 90-26

6x= 64

x= 64/6

x= 10.66

Therefore, the value of x is 10.66

Learn more about complementary angles here: brainly.com/question/98924

#SPJ1

What is the smallest positive integer that is both a multiple of $7$ and a multiple of $4$?

Answers

The smallest positive integer that is both multiple of 4 and 7 is 2

What are multiples?

In mathematics, multiples are the results of multiplying an integer by a given number.

The given numbers for this problem are 4 and 7. The positive multiples of 4 and 7 will be listed and the first number that appeared in the both multiples s the smallest positive integer that is both a multiple of 7 and a multiple of 4.

The multiples of 4

4 8 12 16 20 24 28 32 36 .......

The multiples of 7:

7 14 21 28 35 42 49 56 63 70 77 84 91 98 .....

The smallest common multiple is 28

Learn more about multiples at:

brainly.com/question/28923509

#SPJ1

Can someone tell me what this is?

Answers

Answer:

there's one solution bc the lines have one point in common

I can’t see the numbers on the graph too well but the solution would be where the two points intersect. I thinks it’s (2,4) but I can’t see the numbers on the Y axis so it might not be 4.

Express each number as a product of two numbers 1/5

Answers

The fraction expression as a product expression is 1/2 * 2/5

How to express the mathematical expression as a product expression

From the question, we have the following parameters that can be used in our computation:

A mathematical expression

The mathematical expression is given as

1/5

In this case, the expression is a fraction

Using the above as a guide, we have the following:

Fraction = 1/5

Multiply the fraction by 1

So, we have the following representation

Fraction = 1/5 * 1

Express 1 as 2/2

This gives

Fraction = 1/5 * 2/2

Swap the factors of the expression

This gives

Fraction = 1/2 * 2/5

Hence, the product expression is 1/2 * 2/5

Read more about expression at

https://brainly.com/question/15775046

#SPJ1

How do you know how many real solutions?

Answers

The number of real solutions of a quadratic equation depends on the sign of the discriminant.We can find discriminant by using discriminant formula.

What are real solutions of an equation?

A real solution in algebra is simply a solution to an equation that is a real number. there can be 0, 1, or 2 solutions to a quadratic equation depending on whether the expression inside the square root sign (b2 - 4ac), is positive, negative, or zero.

How many real solutions does the discriminant have?

When the discriminant value is positive we get two real solutions. When the discriminant value is zero we get one real solution. When the discriminant value is negative we get a pair of complex solutions.

So that we can find real solution of quadratic equation by finding discriminant of given equation.

To learn more about real solution visit;

https://brainly.com/question/4526506

#SPJ4

There were 9 pieces of paper. Some of them were cut into 3 pieces. As a result, there
are now 15 pieces of paper. How many pieces of paper were cut?

Answers

Answer:15-9=3

6=3

6÷3

2 is the required answer for this question

Is y 4 a horizontal asymptote?

Answers

Yes, the horizontal asymptote is at y = 4.

The term asymptote in math is known as a straight line that constantly approaches a given curve but does not meet at any infinite distance.

Here we have given the expression y = 4.

In order to find whether it is an horizontal asymptote or not, we have to plot it on the graph,

The first process is to label the graph with x and y axis.

And then we have to defines the scale for the for the graph.

Now, we have to input the expression y = 4 on the graph then we get the graph like the following.

While we looking into the given graph we have identified that the expression y = 4 makes the horizontal asymptote on the graph.

To know more about Asymptote here.

https://brainly.com/question/2303876

#SPJ4

You have a cup with 17 coins inside. The total inside the cup is $5. 50. Determine how many half dollars and quarters are inside the cup. Use a system of equations. Be sure to define the variables and show all work

Answers

There are 8 half dollars and 9 quarters inside the cup.

We can set up a system of equations to represent the number of half dollars (h) and quarters (q) in the cup and the total value of the coins.

Let h be the number of half dollars and q be the number of quarters.

The first equation represents the total number of coins in the cup:

h + q = 17

The second equation represents the total value of the coins:

0.5h + 0.25q = 5.50

To solve for h and q, we can use either the substitution or elimination method.

By substitution, we can solve for one variable in terms of the other in one of the equations and substitute it into the other equation.

So, q = 17 - h

then substitute it into the second equation:

0.5h + 0.25(17 - h) = 5.50

By solving for h, we get h = 8, then we can substitute it back into the first equation to get q = 9

So, there are 8 half dollars and 9 quarters inside the cup.

Learn more about Substitution Method here:

https://brainly.com/question/22340165


#SPJ4

the greatest common factor of 12x-18

Answers

Answer:

6

Step-by-step explanation:

The prime factorization of 12x is 3*2*2x. The prime factorization of 18 is 2*3*3. The same thing that appears in both prime factorizations is 3*2, or 6.

#B4nliest!

Other Questions
An item is regularly priced at $90. It is now priced at a discount of 40% off the regular price. What is the price now? What is the product 4y 3 )( 2y^2 3y 5? please i need help! anything will help The sales charge on a fund with a Net Asset Value of $9.50 and a Public Offering Price of $10.00 is: Me in a good way what is 16 4743 Sort each word or phrase into the appropriate column, based on the type of rhetorical appeal it is associated with.LogosEthosPathos Which of the following was a factor leading to the U.S decision to declare war on Spain in 1998?A: isolationist policy B: labor union pressureC: yellow journalismD: unrestricted naval warfare Dollhouse furnishing comes in different sizes depending on the size of the dollhouse. Write a ratio of the size of the dollhouse item to the size of the larger item. dollhouse sofa: 1 1/2 in. Longreal sofa: 6 ft long What is the exception to prior restraint? Find the domain and range of the graph A. D: X 5 R: y 7B. D: X 7R: y 5C. D : X < 5R: y < 7D. D: X < 7R: y < 5 What does the first paragraph, on pages 1-2, suggest about Isabella's view of her disguise? ? a person appointed to a government position after passing an examination is probably joining the Product costs flow through the inventory accounts until the goods are sold, at which time they are matched against sales on the ______. Multiple choice question. income statement statement of cash flows balance sheet' A square board is attached to a wall. The board is divided into four squares and each square is painted either black or white. In how many ways can the board be painted if we can rotate the given board about its center? The answer is not 14 or 16. Nutrients and ions can pass directly from cell to cell through special membrane junctions known as ________. Where did most people in the US live in 1790? create a new business idea (in detail please) what is the reading of the energy meter in figure 1 when an appropriate laser is used in pac to dissociate a particular chemical bond? -15 POINTS-How many sides does a regular polygon have if one interior angle measures 144 Duncan McClanahan had a ________ performed to correct damage to the septum of his nose.